C10H13N3O3S3 — CID 87927606
N-(cyanomethyl)-3-methylsulfanyl-2-(thiophen-2-ylsulfonylamino)propanamide (PubChem CID 87927606) has the molecular formula C10H13N3O3S3 and a molecular weight of 319.43 g/mol. Its IUPAC name is N-(cyanomethyl)-3-methylsulfanyl-2-(thiophen-2-ylsulfonylamino)propanamide.
| Compound Name | N-(cyanomethyl)-3-methylsulfanyl-2-(thiophen-2-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 87927606 |
| Molecular Formula | C10H13N3O3S3 |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | N-(cyanomethyl)-3-methylsulfanyl-2-(thiophen-2-ylsulfonylamino)propanamide |
| SMILES | CSCC(NS(=O)(=O)c1cccs1)C(=O)NCC#N |
| InChI | InChI=1S/C10H13N3O3S3/c1-17-7-8(10(14)12-5-4-11)13-19(15,16)9-3-2-6-18-9/h2-3,6,8,13H,5,7H2,1H3,(H,12,14) |
| InChIKey | RWIGMXXWRCOLHY-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|