C16H19ClN2O3S3 — CID 126458163
N-(2-chloro-4-methylphenyl)-4-methylsulfanyl-2-(thiophen-2-ylsulfonylamino)butanamide (PubChem CID 126458163) has the molecular formula C16H19ClN2O3S3 and a molecular weight of 418.99 g/mol. Its IUPAC name is N-(2-chloro-4-methylphenyl)-4-methylsulfanyl-2-(thiophen-2-ylsulfonylamino)butanamide.
| Compound Name | N-(2-chloro-4-methylphenyl)-4-methylsulfanyl-2-(thiophen-2-ylsulfonylamino)butanamide |
|---|---|
| PubChem CID | 126458163 |
| Molecular Formula | C16H19ClN2O3S3 |
| Molecular Weight | 418.99 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | N-(2-chloro-4-methylphenyl)-4-methylsulfanyl-2-(thiophen-2-ylsulfonylamino)butanamide |
| SMILES | CSCCC(NS(=O)(=O)c1cccs1)C(=O)Nc1ccc(C)cc1Cl |
| InChI | InChI=1S/C16H19ClN2O3S3/c1-11-5-6-13(12(17)10-11)18-16(20)14(7-9-23-2)19-25(21,22)15-4-3-8-24-15/h3-6,8,10,14,19H,7,9H2,1-2H3,(H,18,20) |
| InChIKey | SBIFJESEYBHIRO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.99 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |