C8H15F2NO2S — CID 106173312
N-(2,2-difluoro-3-hydroxypropyl)-3-methyl-2-sulfanylbutanamide (PubChem CID 106173312) has the molecular formula C8H15F2NO2S and a molecular weight of 227.28 g/mol. Its IUPAC name is N-(2,2-difluoro-3-hydroxypropyl)-3-methyl-2-sulfanylbutanamide.
| Compound Name | N-(2,2-difluoro-3-hydroxypropyl)-3-methyl-2-sulfanylbutanamide |
|---|---|
| PubChem CID | 106173312 |
| Molecular Formula | C8H15F2NO2S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | N-(2,2-difluoro-3-hydroxypropyl)-3-methyl-2-sulfanylbutanamide |
| SMILES | CC(C)C(S)C(=O)NCC(F)(F)CO |
| InChI | InChI=1S/C8H15F2NO2S/c1-5(2)6(14)7(13)11-3-8(9,10)4-12/h5-6,12,14H,3-4H2,1-2H3,(H,11,13) |
| InChIKey | NYKOJXRFMNXPKH-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|