C13H24N2O — CID 83142651
2-cyano-3-methyl-N-(2,3,3-trimethylbutyl)butanamide (PubChem CID 83142651) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is 2-cyano-3-methyl-N-(2,3,3-trimethylbutyl)butanamide.
| Compound Name | 2-cyano-3-methyl-N-(2,3,3-trimethylbutyl)butanamide |
|---|---|
| PubChem CID | 83142651 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 2-cyano-3-methyl-N-(2,3,3-trimethylbutyl)butanamide |
| SMILES | CC(C)C(C#N)C(=O)NCC(C)C(C)(C)C |
| InChI | InChI=1S/C13H24N2O/c1-9(2)11(7-14)12(16)15-8-10(3)13(4,5)6/h9-11H,8H2,1-6H3,(H,15,16) |
| InChIKey | JLMKEFSYTCPAPF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |