C10H18N2O2 — CID 106842207
2-cyano-N-(4-hydroxybutyl)-3-methylbutanamide (PubChem CID 106842207) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 2-cyano-N-(4-hydroxybutyl)-3-methylbutanamide.
| Compound Name | 2-cyano-N-(4-hydroxybutyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 106842207 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 2-cyano-N-(4-hydroxybutyl)-3-methylbutanamide |
| SMILES | CC(C)C(C#N)C(=O)NCCCCO |
| InChI | InChI=1S/C10H18N2O2/c1-8(2)9(7-11)10(14)12-5-3-4-6-13/h8-9,13H,3-6H2,1-2H3,(H,12,14) |
| InChIKey | KUQRSRUYGRZOTC-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|