C20H25ClN2OS — CID 46446913
N-[2-(2-chlorophenyl)-2-pyrrolidin-1-ylethyl]-4-thiophen-2-ylbutanamide (PubChem CID 46446913) has the molecular formula C20H25ClN2OS and a molecular weight of 376.95 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-pyrrolidin-1-ylethyl]-4-thiophen-2-ylbutanamide.
| Compound Name | N-[2-(2-chlorophenyl)-2-pyrrolidin-1-ylethyl]-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 46446913 |
| Molecular Formula | C20H25ClN2OS |
| Molecular Weight | 376.95 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-pyrrolidin-1-ylethyl]-4-thiophen-2-ylbutanamide |
| SMILES | O=C(CCCc1cccs1)NCC(c1ccccc1Cl)N1CCCC1 |
| InChI | InChI=1S/C20H25ClN2OS/c21-18-10-2-1-9-17(18)19(23-12-3-4-13-23)15-22-20(24)11-5-7-16-8-6-14-25-16/h1-2,6,8-10,14,19H,3-5,7,11-13,15H2,(H,22,24) |
| InChIKey | TYZDWUKLJKOYGE-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.95 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |