C23H33N3OS — CID 110302964
N-[2-(4-methylphenyl)-2-(4-methylpiperazin-1-yl)ethyl]-5-thiophen-2-ylpentanamide (PubChem CID 110302964) has the molecular formula C23H33N3OS and a molecular weight of 399.60 g/mol. Its IUPAC name is N-[2-(4-methylphenyl)-2-(4-methylpiperazin-1-yl)ethyl]-5-thiophen-2-ylpentanamide.
| Compound Name | N-[2-(4-methylphenyl)-2-(4-methylpiperazin-1-yl)ethyl]-5-thiophen-2-ylpentanamide |
|---|---|
| PubChem CID | 110302964 |
| Molecular Formula | C23H33N3OS |
| Molecular Weight | 399.60 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | N-[2-(4-methylphenyl)-2-(4-methylpiperazin-1-yl)ethyl]-5-thiophen-2-ylpentanamide |
| SMILES | Cc1ccc(C(CNC(=O)CCCCc2cccs2)N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C23H33N3OS/c1-19-9-11-20(12-10-19)22(26-15-13-25(2)14-16-26)18-24-23(27)8-4-3-6-21-7-5-17-28-21/h5,7,9-12,17,22H,3-4,6,8,13-16,18H2,1-2H3,(H,24,27) |
| InChIKey | GPGPIEVGKJJSFK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.60 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|