C21H26Cl2N2O — CID 52984684
N-[2-(2-chlorophenyl)-2-piperidin-1-ylethyl]-2-phenylacetamide;hydrochloride (PubChem CID 52984684) has the molecular formula C21H26Cl2N2O and a molecular weight of 393.36 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-piperidin-1-ylethyl]-2-phenylacetamide;hydrochloride.
| Compound Name | N-[2-(2-chlorophenyl)-2-piperidin-1-ylethyl]-2-phenylacetamide;hydrochloride |
|---|---|
| PubChem CID | 52984684 |
| Molecular Formula | C21H26Cl2N2O |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-piperidin-1-ylethyl]-2-phenylacetamide;hydrochloride |
| SMILES | Cl.O=C(Cc1ccccc1)NCC(c1ccccc1Cl)N1CCCCC1 |
| InChI | InChI=1S/C21H25ClN2O.ClH/c22-19-12-6-5-11-18(19)20(24-13-7-2-8-14-24)16-23-21(25)15-17-9-3-1-4-10-17;/h1,3-6,9-12,20H,2,7-8,13-16H2,(H,23,25);1H |
| InChIKey | PYRPXXIVOKFFHN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |