C21H23ClFN3O2 — CID 24638619
N-[2-[[2-(2-chlorophenyl)-2-pyrrolidin-1-ylethyl]amino]-2-oxoethyl]-2-fluorobenzamide (PubChem CID 24638619) has the molecular formula C21H23ClFN3O2 and a molecular weight of 403.89 g/mol. Its IUPAC name is N-[2-[[2-(2-chlorophenyl)-2-pyrrolidin-1-ylethyl]amino]-2-oxoethyl]-2-fluorobenzamide.
| Compound Name | N-[2-[[2-(2-chlorophenyl)-2-pyrrolidin-1-ylethyl]amino]-2-oxoethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 24638619 |
| Molecular Formula | C21H23ClFN3O2 |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | N-[2-[[2-(2-chlorophenyl)-2-pyrrolidin-1-ylethyl]amino]-2-oxoethyl]-2-fluorobenzamide |
| SMILES | O=C(CNC(=O)c1ccccc1F)NCC(c1ccccc1Cl)N1CCCC1 |
| InChI | InChI=1S/C21H23ClFN3O2/c22-17-9-3-1-7-15(17)19(26-11-5-6-12-26)13-24-20(27)14-25-21(28)16-8-2-4-10-18(16)23/h1-4,7-10,19H,5-6,11-14H2,(H,24,27)(H,25,28) |
| InChIKey | JTJFRKRTNXILDF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |