About methyl 2-(2-chlorophenyl)-2-(ethylamino)acetate;thiophene
methyl 2-(2-chlorophenyl)-2-(ethylamino)acetate;thiophene (PubChem CID 174652902) has the molecular formula C15H18ClNO2S
and a molecular weight of 311.83 g/mol. Its IUPAC name is methyl 2-(2-chlorophenyl)-2-(ethylamino)acetate;thiophene.
Molecular Properties
| Compound Name | methyl 2-(2-chlorophenyl)-2-(ethylamino)acetate;thiophene |
| PubChem CID | 174652902 |
| Molecular Formula | C15H18ClNO2S |
| Molecular Weight | 311.83 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | methyl 2-(2-chlorophenyl)-2-(ethylamino)acetate;thiophene |
| SMILES | CCNC(C(=O)OC)c1ccccc1Cl.c1ccsc1 |
| InChI | InChI=1S/C11H14ClNO2.C4H4S/c1-3-13-10(11(14)15-2)8-6-4-5-7-9(8)12;1-2-4-5-3-1/h4-7,10,13H,3H2,1-2H3;1-4H |
| InChIKey | PDSVZSUCRWQTIR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.83 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-(2-chlorophenyl)-2-(ethylamino)acetate;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2-chlorophenyl)-2-(ethylamino)acetate;thiophene?
The IUPAC name of methyl 2-(2-chlorophenyl)-2-(ethylamino)acetate;thiophene (CID 174652902) is methyl 2-(2-chlorophenyl)-2-(ethylamino)acetate;thiophene.
What is the SMILES notation for methyl 2-(2-chlorophenyl)-2-(ethylamino)acetate;thiophene?
The canonical SMILES for methyl 2-(2-chlorophenyl)-2-(ethylamino)acetate;thiophene is CCNC(C(=O)OC)c1ccccc1Cl.c1ccsc1.
What is the InChIKey of methyl 2-(2-chlorophenyl)-2-(ethylamino)acetate;thiophene?
The InChIKey is PDSVZSUCRWQTIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClNO2.C4H4S/c1-3-13-10(11(14)15-2)8-6-4-5-7-9(8)12;1-2-4-5-3-1/h4-7,10,13H,3H2,1-2H3;1-4H.
What are the key properties of methyl 2-(2-chlorophenyl)-2-(ethylamino)acetate;thiophene?
methyl 2-(2-chlorophenyl)-2-(ethylamino)acetate;thiophene has a molecular weight of 311.83 g/mol, XLogP of 3.91, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2-chlorophenyl)-2-(ethylamino)acetate;thiophene is sourced from PubChem (CID 174652902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).