C14H18FNO3 — CID 107698194
ethyl 2-(cyclopropylmethylamino)-2-(5-fluoro-2-hydroxyphenyl)acetate (PubChem CID 107698194) has the molecular formula C14H18FNO3 and a molecular weight of 267.30 g/mol. Its IUPAC name is ethyl 2-(cyclopropylmethylamino)-2-(5-fluoro-2-hydroxyphenyl)acetate.
| Compound Name | ethyl 2-(cyclopropylmethylamino)-2-(5-fluoro-2-hydroxyphenyl)acetate |
|---|---|
| PubChem CID | 107698194 |
| Molecular Formula | C14H18FNO3 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | ethyl 2-(cyclopropylmethylamino)-2-(5-fluoro-2-hydroxyphenyl)acetate |
| SMILES | CCOC(=O)C(NCC1CC1)c1cc(F)ccc1O |
| InChI | InChI=1S/C14H18FNO3/c1-2-19-14(18)13(16-8-9-3-4-9)11-7-10(15)5-6-12(11)17/h5-7,9,13,16-17H,2-4,8H2,1H3 |
| InChIKey | SNFYFHUSMXXSOF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|