C14H17F2NO2 — CID 115527084
methyl 2-(cyclopropylmethylamino)-2-[3-(difluoromethyl)phenyl]acetate (PubChem CID 115527084) has the molecular formula C14H17F2NO2 and a molecular weight of 269.29 g/mol. Its IUPAC name is methyl 2-(cyclopropylmethylamino)-2-[3-(difluoromethyl)phenyl]acetate.
| Compound Name | methyl 2-(cyclopropylmethylamino)-2-[3-(difluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 115527084 |
| Molecular Formula | C14H17F2NO2 |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | methyl 2-(cyclopropylmethylamino)-2-[3-(difluoromethyl)phenyl]acetate |
| SMILES | COC(=O)C(NCC1CC1)c1cccc(C(F)F)c1 |
| InChI | InChI=1S/C14H17F2NO2/c1-19-14(18)12(17-8-9-5-6-9)10-3-2-4-11(7-10)13(15)16/h2-4,7,9,12-13,17H,5-6,8H2,1H3 |
| InChIKey | FZCPNTAZUKMICE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |