C18H27NO2 — CID 122038525
(2S)-2-phenyl-2-[(4-propan-2-ylcyclohexyl)methylamino]acetic acid (PubChem CID 122038525) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is (2S)-2-phenyl-2-[(4-propan-2-ylcyclohexyl)methylamino]acetic acid.
| Compound Name | (2S)-2-phenyl-2-[(4-propan-2-ylcyclohexyl)methylamino]acetic acid |
|---|---|
| PubChem CID | 122038525 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | (2S)-2-phenyl-2-[(4-propan-2-ylcyclohexyl)methylamino]acetic acid |
| SMILES | CC(C)C1CCC(CN[C@H](C(=O)O)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H27NO2/c1-13(2)15-10-8-14(9-11-15)12-19-17(18(20)21)16-6-4-3-5-7-16/h3-7,13-15,17,19H,8-12H2,1-2H3,(H,20,21)/t14?,15?,17-/m0/s1 |
| InChIKey | PKLUPVMPHQJCCK-DQPZFDDXSA-N |
| XLogP | 3.86 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |