C10H13NO2S — CID 61002802
2-(cyclopropylmethylamino)-2-thiophen-3-ylacetic acid (PubChem CID 61002802) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is 2-(cyclopropylmethylamino)-2-thiophen-3-ylacetic acid.
| Compound Name | 2-(cyclopropylmethylamino)-2-thiophen-3-ylacetic acid |
|---|---|
| PubChem CID | 61002802 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 2-(cyclopropylmethylamino)-2-thiophen-3-ylacetic acid |
| SMILES | O=C(O)C(NCC1CC1)c1ccsc1 |
| InChI | InChI=1S/C10H13NO2S/c12-10(13)9(8-3-4-14-6-8)11-5-7-1-2-7/h3-4,6-7,9,11H,1-2,5H2,(H,12,13) |
| InChIKey | FMRDKXRYGHTSFM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |