C15H20N4O — CID 65269314
3-amino-2,2,3-trimethyl-N-quinoxalin-6-ylbutanamide (PubChem CID 65269314) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 3-amino-2,2,3-trimethyl-N-quinoxalin-6-ylbutanamide.
| Compound Name | 3-amino-2,2,3-trimethyl-N-quinoxalin-6-ylbutanamide |
|---|---|
| PubChem CID | 65269314 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 3-amino-2,2,3-trimethyl-N-quinoxalin-6-ylbutanamide |
| SMILES | CC(C)(N)C(C)(C)C(=O)Nc1ccc2nccnc2c1 |
| InChI | InChI=1S/C15H20N4O/c1-14(2,15(3,4)16)13(20)19-10-5-6-11-12(9-10)18-8-7-17-11/h5-9H,16H2,1-4H3,(H,19,20) |
| InChIKey | PJCCCWWUGRNEAM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |