C13H21N3O — CID 79240943
3-amino-2,2,3-trimethyl-N-(2-methyl-4-pyridinyl)butanamide (PubChem CID 79240943) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is 3-amino-2,2,3-trimethyl-N-(2-methyl-4-pyridinyl)butanamide.
| Compound Name | 3-amino-2,2,3-trimethyl-N-(2-methyl-4-pyridinyl)butanamide |
|---|---|
| PubChem CID | 79240943 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 3-amino-2,2,3-trimethyl-N-(2-methyl-4-pyridinyl)butanamide |
| SMILES | Cc1cc(NC(=O)C(C)(C)C(C)(C)N)ccn1 |
| InChI | InChI=1S/C13H21N3O/c1-9-8-10(6-7-15-9)16-11(17)12(2,3)13(4,5)14/h6-8H,14H2,1-5H3,(H,15,16,17) |
| InChIKey | MNHSUOLDBJZASB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |