C13H16Cl2N4O2 — CID 76911712
1-(3-amino-3-hydroxyiminopropyl)-1-cyclopropyl-3-(3,4-dichlorophenyl)urea (PubChem CID 76911712) has the molecular formula C13H16Cl2N4O2 and a molecular weight of 331.20 g/mol. Its IUPAC name is 1-(3-amino-3-hydroxyiminopropyl)-1-cyclopropyl-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-(3-amino-3-hydroxyiminopropyl)-1-cyclopropyl-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 76911712 |
| Molecular Formula | C13H16Cl2N4O2 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 1-(3-amino-3-hydroxyiminopropyl)-1-cyclopropyl-3-(3,4-dichlorophenyl)urea |
| SMILES | NC(CCN(C(=O)Nc1ccc(Cl)c(Cl)c1)C1CC1)=NO |
| InChI | InChI=1S/C13H16Cl2N4O2/c14-10-4-1-8(7-11(10)15)17-13(20)19(9-2-3-9)6-5-12(16)18-21/h1,4,7,9,21H,2-3,5-6H2,(H2,16,18)(H,17,20) |
| InChIKey | PCLOOHNLIKXMFF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|