C12H14Cl5N2O4P — CID 12906052
3-(3,4-dichlorophenyl)-1-methyl-1-(2,2,2-trichloro-1-dimethoxyphosphorylethyl)urea (PubChem CID 12906052) has the molecular formula C12H14Cl5N2O4P and a molecular weight of 458.49 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-methyl-1-(2,2,2-trichloro-1-dimethoxyphosphorylethyl)urea.
| Compound Name | 3-(3,4-dichlorophenyl)-1-methyl-1-(2,2,2-trichloro-1-dimethoxyphosphorylethyl)urea |
|---|---|
| PubChem CID | 12906052 |
| Molecular Formula | C12H14Cl5N2O4P |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 455.91 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-methyl-1-(2,2,2-trichloro-1-dimethoxyphosphorylethyl)urea |
| SMILES | COP(=O)(OC)C(N(C)C(=O)Nc1ccc(Cl)c(Cl)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H14Cl5N2O4P/c1-19(10(12(15,16)17)24(21,22-2)23-3)11(20)18-7-4-5-8(13)9(14)6-7/h4-6,10H,1-3H3,(H,18,20) |
| InChIKey | UCHIJDVHYGSJSI-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|