C17H17Cl2N3O3 — CID 118878026
N-(3,4-dichlorophenyl)-3-(dimethylcarbamoylamino)-4-methoxybenzamide (PubChem CID 118878026) has the molecular formula C17H17Cl2N3O3 and a molecular weight of 382.25 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-3-(dimethylcarbamoylamino)-4-methoxybenzamide.
| Compound Name | N-(3,4-dichlorophenyl)-3-(dimethylcarbamoylamino)-4-methoxybenzamide |
|---|---|
| PubChem CID | 118878026 |
| Molecular Formula | C17H17Cl2N3O3 |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | N-(3,4-dichlorophenyl)-3-(dimethylcarbamoylamino)-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(Cl)c(Cl)c2)cc1NC(=O)N(C)C |
| InChI | InChI=1S/C17H17Cl2N3O3/c1-22(2)17(24)21-14-8-10(4-7-15(14)25-3)16(23)20-11-5-6-12(18)13(19)9-11/h4-9H,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | FWOYJUDADGUONF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |