C18H20Cl3N2O4P — CID 4134094
1-[2-(4-chlorophenyl)ethyl]-3-(3,4-dichlorophenyl)-1-(dimethoxyphosphorylmethyl)urea (PubChem CID 4134094) has the molecular formula C18H20Cl3N2O4P and a molecular weight of 465.70 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)ethyl]-3-(3,4-dichlorophenyl)-1-(dimethoxyphosphorylmethyl)urea.
| Compound Name | 1-[2-(4-chlorophenyl)ethyl]-3-(3,4-dichlorophenyl)-1-(dimethoxyphosphorylmethyl)urea |
|---|---|
| PubChem CID | 4134094 |
| Molecular Formula | C18H20Cl3N2O4P |
| Molecular Weight | 465.70 g/mol |
| Exact Mass | 464.02 |
| IUPAC Name | 1-[2-(4-chlorophenyl)ethyl]-3-(3,4-dichlorophenyl)-1-(dimethoxyphosphorylmethyl)urea |
| SMILES | COP(=O)(CN(CCc1ccc(Cl)cc1)C(=O)Nc1ccc(Cl)c(Cl)c1)OC |
| InChI | InChI=1S/C18H20Cl3N2O4P/c1-26-28(25,27-2)12-23(10-9-13-3-5-14(19)6-4-13)18(24)22-15-7-8-16(20)17(21)11-15/h3-8,11H,9-10,12H2,1-2H3,(H,22,24) |
| InChIKey | RTVFOFNEJFUZOK-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.70 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|