C17H16Cl2N2O2S — CID 110189553
S-[3-(3,4-dichloroanilino)-2-methyl-3-oxopropyl] N-phenylcarbamothioate (PubChem CID 110189553) has the molecular formula C17H16Cl2N2O2S and a molecular weight of 383.30 g/mol. Its IUPAC name is S-[3-(3,4-dichloroanilino)-2-methyl-3-oxopropyl] N-phenylcarbamothioate.
| Compound Name | S-[3-(3,4-dichloroanilino)-2-methyl-3-oxopropyl] N-phenylcarbamothioate |
|---|---|
| PubChem CID | 110189553 |
| Molecular Formula | C17H16Cl2N2O2S |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | S-[3-(3,4-dichloroanilino)-2-methyl-3-oxopropyl] N-phenylcarbamothioate |
| SMILES | CC(CSC(=O)Nc1ccccc1)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H16Cl2N2O2S/c1-11(10-24-17(23)21-12-5-3-2-4-6-12)16(22)20-13-7-8-14(18)15(19)9-13/h2-9,11H,10H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | YMIFJIRVVFWCDN-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|