C19H19F3N4O3S — CID 24631082
2-(5-cyano-2,6-dimethylpyrimidin-4-yl)sulfanyl-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]acetamide (PubChem CID 24631082) has the molecular formula C19H19F3N4O3S and a molecular weight of 440.45 g/mol. Its IUPAC name is 2-(5-cyano-2,6-dimethylpyrimidin-4-yl)sulfanyl-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(5-cyano-2,6-dimethylpyrimidin-4-yl)sulfanyl-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 24631082 |
| Molecular Formula | C19H19F3N4O3S |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 2-(5-cyano-2,6-dimethylpyrimidin-4-yl)sulfanyl-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]acetamide |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NC(=O)CSc1nc(C)nc(C)c1C#N |
| InChI | InChI=1S/C19H19F3N4O3S/c1-11-14(9-23)18(25-12(2)24-11)30-10-17(27)26-15-8-13(19(20,21)22)4-5-16(15)29-7-6-28-3/h4-5,8H,6-7,10H2,1-3H3,(H,26,27) |
| InChIKey | YGIOEVYPIJYGNW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|