C18H16F3NO2S — CID 33331905
2,5-dimethyl-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]benzenesulfonamide (PubChem CID 33331905) has the molecular formula C18H16F3NO2S and a molecular weight of 367.39 g/mol. Its IUPAC name is 2,5-dimethyl-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]benzenesulfonamide.
| Compound Name | 2,5-dimethyl-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]benzenesulfonamide |
|---|---|
| PubChem CID | 33331905 |
| Molecular Formula | C18H16F3NO2S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 2,5-dimethyl-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]benzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCC#Cc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C18H16F3NO2S/c1-13-8-9-14(2)17(11-13)25(23,24)22-10-4-6-15-5-3-7-16(12-15)18(19,20)21/h3,5,7-9,11-12,22H,10H2,1-2H3 |
| InChIKey | AVEFHGHUIGPKKZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|