C18H17F3N2O2S — CID 90554379
N-[3-[4-(dimethylamino)phenyl]prop-2-ynyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 90554379) has the molecular formula C18H17F3N2O2S and a molecular weight of 382.41 g/mol. Its IUPAC name is N-[3-[4-(dimethylamino)phenyl]prop-2-ynyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[3-[4-(dimethylamino)phenyl]prop-2-ynyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90554379 |
| Molecular Formula | C18H17F3N2O2S |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N-[3-[4-(dimethylamino)phenyl]prop-2-ynyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CN(C)c1ccc(C#CCNS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H17F3N2O2S/c1-23(2)16-10-8-14(9-11-16)5-4-12-22-26(24,25)17-7-3-6-15(13-17)18(19,20)21/h3,6-11,13,22H,12H2,1-2H3 |
| InChIKey | WZAISNTXOHAFSO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|