C12H18ClF3N2O2S — CID 119973462
N-[2-(ethylamino)ethyl]-2-methyl-5-(trifluoromethyl)benzenesulfonamide;hydrochloride (PubChem CID 119973462) has the molecular formula C12H18ClF3N2O2S and a molecular weight of 346.80 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-2-methyl-5-(trifluoromethyl)benzenesulfonamide;hydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-2-methyl-5-(trifluoromethyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119973462 |
| Molecular Formula | C12H18ClF3N2O2S |
| Molecular Weight | 346.80 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-2-methyl-5-(trifluoromethyl)benzenesulfonamide;hydrochloride |
| SMILES | CCNCCNS(=O)(=O)c1cc(C(F)(F)F)ccc1C.Cl |
| InChI | InChI=1S/C12H17F3N2O2S.ClH/c1-3-16-6-7-17-20(18,19)11-8-10(12(13,14)15)5-4-9(11)2;/h4-5,8,16-17H,3,6-7H2,1-2H3;1H |
| InChIKey | PXSVQEDFVPXAGX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.80 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|