C22H21F4N3O3S — CID 112818111
4-(4-fluorophenyl)sulfonyl-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]-1,4-diazepane-1-carboxamide (PubChem CID 112818111) has the molecular formula C22H21F4N3O3S and a molecular weight of 483.49 g/mol. Its IUPAC name is 4-(4-fluorophenyl)sulfonyl-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]-1,4-diazepane-1-carboxamide.
| Compound Name | 4-(4-fluorophenyl)sulfonyl-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 112818111 |
| Molecular Formula | C22H21F4N3O3S |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | 4-(4-fluorophenyl)sulfonyl-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]-1,4-diazepane-1-carboxamide |
| SMILES | O=C(NCC#Cc1cccc(C(F)(F)F)c1)N1CCCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H21F4N3O3S/c23-19-7-9-20(10-8-19)33(31,32)29-13-3-12-28(14-15-29)21(30)27-11-2-5-17-4-1-6-18(16-17)22(24,25)26/h1,4,6-10,16H,3,11-15H2,(H,27,30) |
| InChIKey | DWNHHSKJQLCYSI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|