C23H22F3N3O2 — CID 112818112
4-N-phenyl-1-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]piperidine-1,4-dicarboxamide (PubChem CID 112818112) has the molecular formula C23H22F3N3O2 and a molecular weight of 429.44 g/mol. Its IUPAC name is 4-N-phenyl-1-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]piperidine-1,4-dicarboxamide.
| Compound Name | 4-N-phenyl-1-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 112818112 |
| Molecular Formula | C23H22F3N3O2 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 4-N-phenyl-1-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]piperidine-1,4-dicarboxamide |
| SMILES | O=C(Nc1ccccc1)C1CCN(C(=O)NCC#Cc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C23H22F3N3O2/c24-23(25,26)19-8-4-6-17(16-19)7-5-13-27-22(31)29-14-11-18(12-15-29)21(30)28-20-9-2-1-3-10-20/h1-4,6,8-10,16,18H,11-15H2,(H,27,31)(H,28,30) |
| InChIKey | QSQOQZNROKAHCN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|