C18H22F3N3 — CID 109497774
1,2-dimethyl-1-pent-4-enyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine (PubChem CID 109497774) has the molecular formula C18H22F3N3 and a molecular weight of 337.39 g/mol. Its IUPAC name is 1,2-dimethyl-1-pent-4-enyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine.
| Compound Name | 1,2-dimethyl-1-pent-4-enyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine |
|---|---|
| PubChem CID | 109497774 |
| Molecular Formula | C18H22F3N3 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 1,2-dimethyl-1-pent-4-enyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine |
| SMILES | C=CCCCN(C)/C(=N\C)NCC#Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H22F3N3/c1-4-5-6-13-24(3)17(22-2)23-12-8-10-15-9-7-11-16(14-15)18(19,20)21/h4,7,9,11,14H,1,5-6,12-13H2,2-3H3,(H,22,23) |
| InChIKey | KTMDZWFAYYVIHH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|