C19H27F3N4O — CID 110043843
N,N-dimethyl-2-[[N-methyl-N-pent-4-enyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide (PubChem CID 110043843) has the molecular formula C19H27F3N4O and a molecular weight of 384.45 g/mol. Its IUPAC name is N,N-dimethyl-2-[[N-methyl-N-pent-4-enyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[N-methyl-N-pent-4-enyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 110043843 |
| Molecular Formula | C19H27F3N4O |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | N,N-dimethyl-2-[[N-methyl-N-pent-4-enyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide |
| SMILES | C=CCCCN(C)/C(=N\Cc1cccc(C(F)(F)F)c1)NCC(=O)N(C)C |
| InChI | InChI=1S/C19H27F3N4O/c1-5-6-7-11-26(4)18(24-14-17(27)25(2)3)23-13-15-9-8-10-16(12-15)19(20,21)22/h5,8-10,12H,1,6-7,11,13-14H2,2-4H3,(H,23,24) |
| InChIKey | OVQLHBCVWWJCQH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|