C19H24F3N5OS — CID 110049064
N,N-dimethyl-2-[[N-methyl-N-[2-(1,3-thiazol-2-yl)ethyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide (PubChem CID 110049064) has the molecular formula C19H24F3N5OS and a molecular weight of 427.50 g/mol. Its IUPAC name is N,N-dimethyl-2-[[N-methyl-N-[2-(1,3-thiazol-2-yl)ethyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[N-methyl-N-[2-(1,3-thiazol-2-yl)ethyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 110049064 |
| Molecular Formula | C19H24F3N5OS |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | N,N-dimethyl-2-[[N-methyl-N-[2-(1,3-thiazol-2-yl)ethyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide |
| SMILES | CN(C)C(=O)CN/C(=N/Cc1cccc(C(F)(F)F)c1)N(C)CCc1nccs1 |
| InChI | InChI=1S/C19H24F3N5OS/c1-26(2)17(28)13-25-18(27(3)9-7-16-23-8-10-29-16)24-12-14-5-4-6-15(11-14)19(20,21)22/h4-6,8,10-11H,7,9,12-13H2,1-3H3,(H,24,25) |
| InChIKey | XQFADPAKPKLCQG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 60.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|