C17H28N4O — CID 111159495
2-[(N'-benzyl-N-butyl-N-methylcarbamimidoyl)amino]-N,N-dimethylacetamide (PubChem CID 111159495) has the molecular formula C17H28N4O and a molecular weight of 304.44 g/mol. Its IUPAC name is 2-[(N'-benzyl-N-butyl-N-methylcarbamimidoyl)amino]-N,N-dimethylacetamide.
| Compound Name | 2-[(N'-benzyl-N-butyl-N-methylcarbamimidoyl)amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111159495 |
| Molecular Formula | C17H28N4O |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | 2-[(N'-benzyl-N-butyl-N-methylcarbamimidoyl)amino]-N,N-dimethylacetamide |
| SMILES | CCCCN(C)/C(=N\Cc1ccccc1)NCC(=O)N(C)C |
| InChI | InChI=1S/C17H28N4O/c1-5-6-12-21(4)17(19-14-16(22)20(2)3)18-13-15-10-8-7-9-11-15/h7-11H,5-6,12-14H2,1-4H3,(H,18,19) |
| InChIKey | DBVGNZXUZZJVSH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|