C21H31F3IN3O — CID 109498393
1,2-dimethyl-1-pent-4-enyl-3-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]guanidine;hydroiodide (PubChem CID 109498393) has the molecular formula C21H31F3IN3O and a molecular weight of 525.40 g/mol. Its IUPAC name is 1,2-dimethyl-1-pent-4-enyl-3-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-1-pent-4-enyl-3-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109498393 |
| Molecular Formula | C21H31F3IN3O |
| Molecular Weight | 525.40 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | 1,2-dimethyl-1-pent-4-enyl-3-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]guanidine;hydroiodide |
| SMILES | C=CCCCN(C)/C(=N\C)NCC1(c2cccc(C(F)(F)F)c2)CCOCC1.I |
| InChI | InChI=1S/C21H30F3N3O.HI/c1-4-5-6-12-27(3)19(25-2)26-16-20(10-13-28-14-11-20)17-8-7-9-18(15-17)21(22,23)24;/h4,7-9,15H,1,5-6,10-14,16H2,2-3H3,(H,25,26);1H |
| InChIKey | KYDPSGOEAQYYST-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|