C24H24N2O2 — CID 90239201
6-(cyclohexen-1-yl)-3,4-bis(phenylmethoxy)pyridazine (PubChem CID 90239201) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 6-(cyclohexen-1-yl)-3,4-bis(phenylmethoxy)pyridazine.
| Compound Name | 6-(cyclohexen-1-yl)-3,4-bis(phenylmethoxy)pyridazine |
|---|---|
| PubChem CID | 90239201 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 6-(cyclohexen-1-yl)-3,4-bis(phenylmethoxy)pyridazine |
| SMILES | C1=C(c2cc(OCc3ccccc3)c(OCc3ccccc3)nn2)CCCC1 |
| InChI | InChI=1S/C24H24N2O2/c1-4-10-19(11-5-1)17-27-23-16-22(21-14-8-3-9-15-21)25-26-24(23)28-18-20-12-6-2-7-13-20/h1-2,4-7,10-14,16H,3,8-9,15,17-18H2 |
| InChIKey | DUXGEPLROISNFC-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |