C19H19N3O — CID 110186685
3-[(4-phenylmethoxyphenyl)methyl]pyridine-2,6-diamine (PubChem CID 110186685) has the molecular formula C19H19N3O and a molecular weight of 305.38 g/mol. Its IUPAC name is 3-[(4-phenylmethoxyphenyl)methyl]pyridine-2,6-diamine.
| Compound Name | 3-[(4-phenylmethoxyphenyl)methyl]pyridine-2,6-diamine |
|---|---|
| PubChem CID | 110186685 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 3-[(4-phenylmethoxyphenyl)methyl]pyridine-2,6-diamine |
| SMILES | Nc1ccc(Cc2ccc(OCc3ccccc3)cc2)c(N)n1 |
| InChI | InChI=1S/C19H19N3O/c20-18-11-8-16(19(21)22-18)12-14-6-9-17(10-7-14)23-13-15-4-2-1-3-5-15/h1-11H,12-13H2,(H4,20,21,22) |
| InChIKey | ZIJJMVIGHQAUTB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |