C24H26N4O3 — CID 143647903
6-amino-N'-[2-(4-phenylmethoxyphenyl)acetyl]-2-propan-2-ylpyridine-3-carbohydrazide (PubChem CID 143647903) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is 6-amino-N'-[2-(4-phenylmethoxyphenyl)acetyl]-2-propan-2-ylpyridine-3-carbohydrazide.
| Compound Name | 6-amino-N'-[2-(4-phenylmethoxyphenyl)acetyl]-2-propan-2-ylpyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 143647903 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 6-amino-N'-[2-(4-phenylmethoxyphenyl)acetyl]-2-propan-2-ylpyridine-3-carbohydrazide |
| SMILES | CC(C)c1nc(N)ccc1C(=O)NNC(=O)Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H26N4O3/c1-16(2)23-20(12-13-21(25)26-23)24(30)28-27-22(29)14-17-8-10-19(11-9-17)31-15-18-6-4-3-5-7-18/h3-13,16H,14-15H2,1-2H3,(H2,25,26)(H,27,29)(H,28,30) |
| InChIKey | GUPYKIQRTHZYML-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|