C31H31N3O5 — CID 10625922
2-(1,3-dioxoisoindol-2-yl)-N-[2-[2-(N-methylanilino)-2-oxoethoxy]phenyl]-N-(4-methylpent-3-enyl)acetamide (PubChem CID 10625922) has the molecular formula C31H31N3O5 and a molecular weight of 525.61 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[2-[2-(N-methylanilino)-2-oxoethoxy]phenyl]-N-(4-methylpent-3-enyl)acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[2-[2-(N-methylanilino)-2-oxoethoxy]phenyl]-N-(4-methylpent-3-enyl)acetamide |
|---|---|
| PubChem CID | 10625922 |
| Molecular Formula | C31H31N3O5 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[2-[2-(N-methylanilino)-2-oxoethoxy]phenyl]-N-(4-methylpent-3-enyl)acetamide |
| SMILES | CC(C)=CCCN(C(=O)CN1C(=O)c2ccccc2C1=O)c1ccccc1OCC(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C31H31N3O5/c1-22(2)12-11-19-33(28(35)20-34-30(37)24-15-7-8-16-25(24)31(34)38)26-17-9-10-18-27(26)39-21-29(36)32(3)23-13-5-4-6-14-23/h4-10,12-18H,11,19-21H2,1-3H3 |
| InChIKey | VVALRDDUZZSMFS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|