C23H22N4O4 — CID 166205052
3-(1,3-dioxoisoindol-2-yl)propyl 1-cyclopentylpyrazolo[3,4-b]pyridine-5-carboxylate (PubChem CID 166205052) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)propyl 1-cyclopentylpyrazolo[3,4-b]pyridine-5-carboxylate.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)propyl 1-cyclopentylpyrazolo[3,4-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 166205052 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)propyl 1-cyclopentylpyrazolo[3,4-b]pyridine-5-carboxylate |
| SMILES | O=C(OCCCN1C(=O)c2ccccc2C1=O)c1cnc2c(cnn2C2CCCC2)c1 |
| InChI | InChI=1S/C23H22N4O4/c28-21-18-8-3-4-9-19(18)22(29)26(21)10-5-11-31-23(30)16-12-15-14-25-27(20(15)24-13-16)17-6-1-2-7-17/h3-4,8-9,12-14,17H,1-2,5-7,10-11H2 |
| InChIKey | JSTDLASDZKIWPN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 94.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|