C20H17N3O4 — CID 99812861
2-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)ethyl 2,3-dimethyl-1H-indole-5-carboxylate (PubChem CID 99812861) has the molecular formula C20H17N3O4 and a molecular weight of 363.37 g/mol. Its IUPAC name is 2-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)ethyl 2,3-dimethyl-1H-indole-5-carboxylate.
| Compound Name | 2-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)ethyl 2,3-dimethyl-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 99812861 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 2-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)ethyl 2,3-dimethyl-1H-indole-5-carboxylate |
| SMILES | Cc1[nH]c2ccc(C(=O)OCCN3C(=O)c4ccncc4C3=O)cc2c1C |
| InChI | InChI=1S/C20H17N3O4/c1-11-12(2)22-17-4-3-13(9-15(11)17)20(26)27-8-7-23-18(24)14-5-6-21-10-16(14)19(23)25/h3-6,9-10,22H,7-8H2,1-2H3 |
| InChIKey | OCRLJMMSHCQCIL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|