C18H26N2O7 — CID 108932364
ethyl [4-[3-[[2-(2-methoxyethoxy)acetyl]amino]propylcarbamoyl]phenyl] carbonate (PubChem CID 108932364) has the molecular formula C18H26N2O7 and a molecular weight of 382.41 g/mol. Its IUPAC name is ethyl [4-[3-[[2-(2-methoxyethoxy)acetyl]amino]propylcarbamoyl]phenyl] carbonate.
| Compound Name | ethyl [4-[3-[[2-(2-methoxyethoxy)acetyl]amino]propylcarbamoyl]phenyl] carbonate |
|---|---|
| PubChem CID | 108932364 |
| Molecular Formula | C18H26N2O7 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | ethyl [4-[3-[[2-(2-methoxyethoxy)acetyl]amino]propylcarbamoyl]phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)NCCCNC(=O)COCCOC)cc1 |
| InChI | InChI=1S/C18H26N2O7/c1-3-26-18(23)27-15-7-5-14(6-8-15)17(22)20-10-4-9-19-16(21)13-25-12-11-24-2/h5-8H,3-4,9-13H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | AVZSMRYBGBESAQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|