C24H30N2O6 — CID 108932308
ethyl [4-[3-[[2-(2,3,6-trimethylphenoxy)acetyl]amino]propylcarbamoyl]phenyl] carbonate (PubChem CID 108932308) has the molecular formula C24H30N2O6 and a molecular weight of 442.51 g/mol. Its IUPAC name is ethyl [4-[3-[[2-(2,3,6-trimethylphenoxy)acetyl]amino]propylcarbamoyl]phenyl] carbonate.
| Compound Name | ethyl [4-[3-[[2-(2,3,6-trimethylphenoxy)acetyl]amino]propylcarbamoyl]phenyl] carbonate |
|---|---|
| PubChem CID | 108932308 |
| Molecular Formula | C24H30N2O6 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | ethyl [4-[3-[[2-(2,3,6-trimethylphenoxy)acetyl]amino]propylcarbamoyl]phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)NCCCNC(=O)COc2c(C)ccc(C)c2C)cc1 |
| InChI | InChI=1S/C24H30N2O6/c1-5-30-24(29)32-20-11-9-19(10-12-20)23(28)26-14-6-13-25-21(27)15-31-22-17(3)8-7-16(2)18(22)4/h7-12H,5-6,13-15H2,1-4H3,(H,25,27)(H,26,28) |
| InChIKey | GEWDGESYQOVFGF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|