C15H20N2O6 — CID 108570522
[4-[2-(ethoxycarbonylamino)ethylcarbamoyl]phenyl] ethyl carbonate (PubChem CID 108570522) has the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. Its IUPAC name is [4-[2-(ethoxycarbonylamino)ethylcarbamoyl]phenyl] ethyl carbonate.
| Compound Name | [4-[2-(ethoxycarbonylamino)ethylcarbamoyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108570522 |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | [4-[2-(ethoxycarbonylamino)ethylcarbamoyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)NCCNC(=O)c1ccc(OC(=O)OCC)cc1 |
| InChI | InChI=1S/C15H20N2O6/c1-3-21-14(19)17-10-9-16-13(18)11-5-7-12(8-6-11)23-15(20)22-4-2/h5-8H,3-4,9-10H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | VDJBCMUHLMXHOB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|