C22H25FN2O5 — CID 108932397
ethyl [4-[3-[3-(3-fluorophenyl)propanoylamino]propylcarbamoyl]phenyl] carbonate (PubChem CID 108932397) has the molecular formula C22H25FN2O5 and a molecular weight of 416.45 g/mol. Its IUPAC name is ethyl [4-[3-[3-(3-fluorophenyl)propanoylamino]propylcarbamoyl]phenyl] carbonate.
| Compound Name | ethyl [4-[3-[3-(3-fluorophenyl)propanoylamino]propylcarbamoyl]phenyl] carbonate |
|---|---|
| PubChem CID | 108932397 |
| Molecular Formula | C22H25FN2O5 |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | ethyl [4-[3-[3-(3-fluorophenyl)propanoylamino]propylcarbamoyl]phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)NCCCNC(=O)CCc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C22H25FN2O5/c1-2-29-22(28)30-19-10-8-17(9-11-19)21(27)25-14-4-13-24-20(26)12-7-16-5-3-6-18(23)15-16/h3,5-6,8-11,15H,2,4,7,12-14H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | XOWDXWZXMINJJR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|