C18H16ClF3N4O2S — CID 46546023
N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]acetamide (PubChem CID 46546023) has the molecular formula C18H16ClF3N4O2S and a molecular weight of 444.87 g/mol. Its IUPAC name is N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 46546023 |
| Molecular Formula | C18H16ClF3N4O2S |
| Molecular Weight | 444.87 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]acetamide |
| SMILES | Cc1ccc(-c2nc(CC(=O)NCCNc3ncc(C(F)(F)F)cc3Cl)cs2)o1 |
| InChI | InChI=1S/C18H16ClF3N4O2S/c1-10-2-3-14(28-10)17-26-12(9-29-17)7-15(27)23-4-5-24-16-13(19)6-11(8-25-16)18(20,21)22/h2-3,6,8-9H,4-5,7H2,1H3,(H,23,27)(H,24,25) |
| InChIKey | WVMPNEYSGRECQN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.87 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|