C17H26Cl2N4O2S — CID 119392951
2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]-N-(3-piperazin-1-ylpropyl)acetamide;dihydrochloride (PubChem CID 119392951) has the molecular formula C17H26Cl2N4O2S and a molecular weight of 421.39 g/mol. Its IUPAC name is 2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]-N-(3-piperazin-1-ylpropyl)acetamide;dihydrochloride.
| Compound Name | 2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]-N-(3-piperazin-1-ylpropyl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119392951 |
| Molecular Formula | C17H26Cl2N4O2S |
| Molecular Weight | 421.39 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]-N-(3-piperazin-1-ylpropyl)acetamide;dihydrochloride |
| SMILES | Cc1ccc(-c2nc(CC(=O)NCCCN3CCNCC3)cs2)o1.Cl.Cl |
| InChI | InChI=1S/C17H24N4O2S.2ClH/c1-13-3-4-15(23-13)17-20-14(12-24-17)11-16(22)19-5-2-8-21-9-6-18-7-10-21;;/h3-4,12,18H,2,5-11H2,1H3,(H,19,22);2*1H |
| InChIKey | RXCDVUFHEXKURS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|