C16H9ClF3N3O2 — CID 3270209
2-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]indol-3-yl]-2-oxoacetamide (PubChem CID 3270209) has the molecular formula C16H9ClF3N3O2 and a molecular weight of 367.71 g/mol. Its IUPAC name is 2-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]indol-3-yl]-2-oxoacetamide.
| Compound Name | 2-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]indol-3-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 3270209 |
| Molecular Formula | C16H9ClF3N3O2 |
| Molecular Weight | 367.71 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | 2-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]indol-3-yl]-2-oxoacetamide |
| SMILES | NC(=O)C(=O)c1cn(-c2ncc(C(F)(F)F)cc2Cl)c2ccccc12 |
| InChI | InChI=1S/C16H9ClF3N3O2/c17-11-5-8(16(18,19)20)6-22-15(11)23-7-10(13(24)14(21)25)9-3-1-2-4-12(9)23/h1-7H,(H2,21,25) |
| InChIKey | LJNWJHVYJUGJPM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.71 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|