C9H8ClF3N2S — CID 62784818
2-(azetidin-3-ylsulfanyl)-3-chloro-5-(trifluoromethyl)pyridine (PubChem CID 62784818) has the molecular formula C9H8ClF3N2S and a molecular weight of 268.69 g/mol. Its IUPAC name is 2-(azetidin-3-ylsulfanyl)-3-chloro-5-(trifluoromethyl)pyridine.
| Compound Name | 2-(azetidin-3-ylsulfanyl)-3-chloro-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 62784818 |
| Molecular Formula | C9H8ClF3N2S |
| Molecular Weight | 268.69 g/mol |
| Exact Mass | 268.00 |
| IUPAC Name | 2-(azetidin-3-ylsulfanyl)-3-chloro-5-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1cnc(SC2CNC2)c(Cl)c1 |
| InChI | InChI=1S/C9H8ClF3N2S/c10-7-1-5(9(11,12)13)2-15-8(7)16-6-3-14-4-6/h1-2,6,14H,3-4H2 |
| InChIKey | FOEPZAKBCRMXRB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.69 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |