C14H7ClF4N2S — CID 112806310
3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]-4-fluorobenzonitrile (PubChem CID 112806310) has the molecular formula C14H7ClF4N2S and a molecular weight of 346.74 g/mol. Its IUPAC name is 3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]-4-fluorobenzonitrile.
| Compound Name | 3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 112806310 |
| Molecular Formula | C14H7ClF4N2S |
| Molecular Weight | 346.74 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]-4-fluorobenzonitrile |
| SMILES | N#Cc1ccc(F)c(CSc2ncc(C(F)(F)F)cc2Cl)c1 |
| InChI | InChI=1S/C14H7ClF4N2S/c15-11-4-10(14(17,18)19)6-21-13(11)22-7-9-3-8(5-20)1-2-12(9)16/h1-4,6H,7H2 |
| InChIKey | XAPNFOFHAJBPDF-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.74 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |