C11H16FN3O — CID 77029557
3-(5-fluoro-2-methylanilino)-N'-hydroxy-2-methylpropanimidamide (PubChem CID 77029557) has the molecular formula C11H16FN3O and a molecular weight of 225.27 g/mol. Its IUPAC name is 3-(5-fluoro-2-methylanilino)-N'-hydroxy-2-methylpropanimidamide.
| Compound Name | 3-(5-fluoro-2-methylanilino)-N'-hydroxy-2-methylpropanimidamide |
|---|---|
| PubChem CID | 77029557 |
| Molecular Formula | C11H16FN3O |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 3-(5-fluoro-2-methylanilino)-N'-hydroxy-2-methylpropanimidamide |
| SMILES | Cc1ccc(F)cc1NCC(C)C(N)=NO |
| InChI | InChI=1S/C11H16FN3O/c1-7-3-4-9(12)5-10(7)14-6-8(2)11(13)15-16/h3-5,8,14,16H,6H2,1-2H3,(H2,13,15) |
| InChIKey | MRTUMUUUKDCHQG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|