C10H14IN3O — CID 77030216
N'-hydroxy-3-(4-iodoanilino)-2-methylpropanimidamide (PubChem CID 77030216) has the molecular formula C10H14IN3O and a molecular weight of 319.15 g/mol. Its IUPAC name is N'-hydroxy-3-(4-iodoanilino)-2-methylpropanimidamide.
| Compound Name | N'-hydroxy-3-(4-iodoanilino)-2-methylpropanimidamide |
|---|---|
| PubChem CID | 77030216 |
| Molecular Formula | C10H14IN3O |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | N'-hydroxy-3-(4-iodoanilino)-2-methylpropanimidamide |
| SMILES | CC(CNc1ccc(I)cc1)C(N)=NO |
| InChI | InChI=1S/C10H14IN3O/c1-7(10(12)14-15)6-13-9-4-2-8(11)3-5-9/h2-5,7,13,15H,6H2,1H3,(H2,12,14) |
| InChIKey | BWWJVSNZCWHJBI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|