C12H18BrClN2 — CID 107445847
N-(3-bromo-4-chlorophenyl)-N'-tert-butylethane-1,2-diamine (PubChem CID 107445847) has the molecular formula C12H18BrClN2 and a molecular weight of 305.65 g/mol. Its IUPAC name is N-(3-bromo-4-chlorophenyl)-N'-tert-butylethane-1,2-diamine.
| Compound Name | N-(3-bromo-4-chlorophenyl)-N'-tert-butylethane-1,2-diamine |
|---|---|
| PubChem CID | 107445847 |
| Molecular Formula | C12H18BrClN2 |
| Molecular Weight | 305.65 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | N-(3-bromo-4-chlorophenyl)-N'-tert-butylethane-1,2-diamine |
| SMILES | CC(C)(C)NCCNc1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C12H18BrClN2/c1-12(2,3)16-7-6-15-9-4-5-11(14)10(13)8-9/h4-5,8,15-16H,6-7H2,1-3H3 |
| InChIKey | SEBBSNRBJOJRNZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.65 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|